C14H17ClO4 — CID 117458268
1-(2-chloro-3,4-dimethoxyphenyl)cyclopentane-1-carboxylic acid (PubChem CID 117458268) has the molecular formula C14H17ClO4 and a molecular weight of 284.74 g/mol. Its IUPAC name is 1-(2-chloro-3,4-dimethoxyphenyl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(2-chloro-3,4-dimethoxyphenyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 117458268 |
| Molecular Formula | C14H17ClO4 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 1-(2-chloro-3,4-dimethoxyphenyl)cyclopentane-1-carboxylic acid |
| SMILES | COc1ccc(C2(C(=O)O)CCCC2)c(Cl)c1OC |
| InChI | InChI=1S/C14H17ClO4/c1-18-10-6-5-9(11(15)12(10)19-2)14(13(16)17)7-3-4-8-14/h5-6H,3-4,7-8H2,1-2H3,(H,16,17) |
| InChIKey | CDGYCHOIDRQNEK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |