1-(2,3-dimethoxy-6-methylphenyl)cyclohexane-1-carboxylic acid

C16H22O4 — CID 117446124

IUPAC1-(2,3-dimethoxy-6-methylphenyl)cyclohexane-1-carboxylic acid
SMILESCOc1ccc(C)c(C2(C(=O)O)CCCCC2)c1OC
InChIInChI=1S/C16H22O4/c1-11-7-8-12(19-2)14(20-3)13(11)16(15(17)18)9-5-4-6-10-16/h7-8H,4-6,9-10H2,1-3H3,(H,17,18)
InChIKeyUJEHPGBZZMFVEW-UHFFFAOYSA-N
MW278.35 g/mol
LogP3.30
Rot. Bonds4

About 1-(2,3-dimethoxy-6-methylphenyl)cyclohexane-1-carboxylic acid

1-(2,3-dimethoxy-6-methylphenyl)cyclohexane-1-carboxylic acid (PubChem CID 117446124) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is 1-(2,3-dimethoxy-6-methylphenyl)cyclohexane-1-carboxylic acid.

Molecular Properties

Compound Name1-(2,3-dimethoxy-6-methylphenyl)cyclohexane-1-carboxylic acid
PubChem CID117446124
Molecular FormulaC16H22O4
Molecular Weight278.35 g/mol
Exact Mass278.15
IUPAC Name1-(2,3-dimethoxy-6-methylphenyl)cyclohexane-1-carboxylic acid
SMILESCOc1ccc(C)c(C2(C(=O)O)CCCCC2)c1OC
InChIInChI=1S/C16H22O4/c1-11-7-8-12(19-2)14(20-3)13(11)16(15(17)18)9-5-4-6-10-16/h7-8H,4-6,9-10H2,1-3H3,(H,17,18)
InChIKeyUJEHPGBZZMFVEW-UHFFFAOYSA-N
XLogP3.30
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500278.35
LogP ≤ 53.30
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 1-(2,3-dimethoxy-6-methylphenyl)cyclohexane-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(2,3-dimethoxy-6-methylphenyl)cyclohexane-1-carboxylic acid?
The IUPAC name of 1-(2,3-dimethoxy-6-methylphenyl)cyclohexane-1-carboxylic acid (CID 117446124) is 1-(2,3-dimethoxy-6-methylphenyl)cyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-(2,3-dimethoxy-6-methylphenyl)cyclohexane-1-carboxylic acid?
The canonical SMILES for 1-(2,3-dimethoxy-6-methylphenyl)cyclohexane-1-carboxylic acid is COc1ccc(C)c(C2(C(=O)O)CCCCC2)c1OC.
What is the InChIKey of 1-(2,3-dimethoxy-6-methylphenyl)cyclohexane-1-carboxylic acid?
The InChIKey is UJEHPGBZZMFVEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22O4/c1-11-7-8-12(19-2)14(20-3)13(11)16(15(17)18)9-5-4-6-10-16/h7-8H,4-6,9-10H2,1-3H3,(H,17,18).
What are the key properties of 1-(2,3-dimethoxy-6-methylphenyl)cyclohexane-1-carboxylic acid?
1-(2,3-dimethoxy-6-methylphenyl)cyclohexane-1-carboxylic acid has a molecular weight of 278.35 g/mol, XLogP of 3.30, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dimethoxy-6-methylphenyl)cyclohexane-1-carboxylic acid is sourced from PubChem (CID 117446124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).