C16H20O4 — CID 117442429
5-(1-carboxycyclohexyl)-2,3-dimethylbenzoic acid (PubChem CID 117442429) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 5-(1-carboxycyclohexyl)-2,3-dimethylbenzoic acid.
| Compound Name | 5-(1-carboxycyclohexyl)-2,3-dimethylbenzoic acid |
|---|---|
| PubChem CID | 117442429 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 5-(1-carboxycyclohexyl)-2,3-dimethylbenzoic acid |
| SMILES | Cc1cc(C2(C(=O)O)CCCCC2)cc(C(=O)O)c1C |
| InChI | InChI=1S/C16H20O4/c1-10-8-12(9-13(11(10)2)14(17)18)16(15(19)20)6-4-3-5-7-16/h8-9H,3-7H2,1-2H3,(H,17,18)(H,19,20) |
| InChIKey | KVKAHVQZVGWSFH-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |