C15H19ClO2 — CID 117420844
1-(5-chloro-2,3-dimethylphenyl)cyclohexane-1-carboxylic acid (PubChem CID 117420844) has the molecular formula C15H19ClO2 and a molecular weight of 266.77 g/mol. Its IUPAC name is 1-(5-chloro-2,3-dimethylphenyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(5-chloro-2,3-dimethylphenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 117420844 |
| Molecular Formula | C15H19ClO2 |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | 1-(5-chloro-2,3-dimethylphenyl)cyclohexane-1-carboxylic acid |
| SMILES | Cc1cc(Cl)cc(C2(C(=O)O)CCCCC2)c1C |
| InChI | InChI=1S/C15H19ClO2/c1-10-8-12(16)9-13(11(10)2)15(14(17)18)6-4-3-5-7-15/h8-9H,3-7H2,1-2H3,(H,17,18) |
| InChIKey | GMVUBHFSMRVOCV-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |