C14H18O2 — CID 117311256
1-(2,3,5-trimethylphenyl)cyclobutane-1-carboxylic acid (PubChem CID 117311256) has the molecular formula C14H18O2 and a molecular weight of 218.30 g/mol. Its IUPAC name is 1-(2,3,5-trimethylphenyl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(2,3,5-trimethylphenyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 117311256 |
| Molecular Formula | C14H18O2 |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 1-(2,3,5-trimethylphenyl)cyclobutane-1-carboxylic acid |
| SMILES | Cc1cc(C)c(C)c(C2(C(=O)O)CCC2)c1 |
| InChI | InChI=1S/C14H18O2/c1-9-7-10(2)11(3)12(8-9)14(13(15)16)5-4-6-14/h7-8H,4-6H2,1-3H3,(H,15,16) |
| InChIKey | FFLZQEMTHJHXMR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |