C15H20O2 — CID 117336685
1-(3,4,5-trimethylphenyl)cyclopentane-1-carboxylic acid (PubChem CID 117336685) has the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. Its IUPAC name is 1-(3,4,5-trimethylphenyl)cyclopentane-1-carboxylic acid.
| Compound Name | 1-(3,4,5-trimethylphenyl)cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 117336685 |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.15 |
| IUPAC Name | 1-(3,4,5-trimethylphenyl)cyclopentane-1-carboxylic acid |
| SMILES | Cc1cc(C2(C(=O)O)CCCC2)cc(C)c1C |
| InChI | InChI=1S/C15H20O2/c1-10-8-13(9-11(2)12(10)3)15(14(16)17)6-4-5-7-15/h8-9H,4-7H2,1-3H3,(H,16,17) |
| InChIKey | SFJSQKZJHZLIME-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |