C16H23NO2 — CID 106702527
1-(2-amino-3,5-dimethylphenyl)cycloheptane-1-carboxylic acid (PubChem CID 106702527) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 1-(2-amino-3,5-dimethylphenyl)cycloheptane-1-carboxylic acid.
| Compound Name | 1-(2-amino-3,5-dimethylphenyl)cycloheptane-1-carboxylic acid |
|---|---|
| PubChem CID | 106702527 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 1-(2-amino-3,5-dimethylphenyl)cycloheptane-1-carboxylic acid |
| SMILES | Cc1cc(C)c(N)c(C2(C(=O)O)CCCCCC2)c1 |
| InChI | InChI=1S/C16H23NO2/c1-11-9-12(2)14(17)13(10-11)16(15(18)19)7-5-3-4-6-8-16/h9-10H,3-8,17H2,1-2H3,(H,18,19) |
| InChIKey | WJWWDYCPTNQHKZ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|