C13H17NO2 — CID 106702438
1-(2-amino-3,5-dimethylphenyl)-2-methylcyclopropane-1-carboxylic acid (PubChem CID 106702438) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 1-(2-amino-3,5-dimethylphenyl)-2-methylcyclopropane-1-carboxylic acid.
| Compound Name | 1-(2-amino-3,5-dimethylphenyl)-2-methylcyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 106702438 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 1-(2-amino-3,5-dimethylphenyl)-2-methylcyclopropane-1-carboxylic acid |
| SMILES | Cc1cc(C)c(N)c(C2(C(=O)O)CC2C)c1 |
| InChI | InChI=1S/C13H17NO2/c1-7-4-8(2)11(14)10(5-7)13(12(15)16)6-9(13)3/h4-5,9H,6,14H2,1-3H3,(H,15,16) |
| InChIKey | AKSYMXWLXDWXQN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|