C12H14O2 — CID 83483787
2-methyl-1-(2-methylphenyl)cyclopropane-1-carboxylic acid (PubChem CID 83483787) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is 2-methyl-1-(2-methylphenyl)cyclopropane-1-carboxylic acid.
| Compound Name | 2-methyl-1-(2-methylphenyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 83483787 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 2-methyl-1-(2-methylphenyl)cyclopropane-1-carboxylic acid |
| SMILES | Cc1ccccc1C1(C(=O)O)CC1C |
| InChI | InChI=1S/C12H14O2/c1-8-5-3-4-6-10(8)12(11(13)14)7-9(12)2/h3-6,9H,7H2,1-2H3,(H,13,14) |
| InChIKey | ZLDKPZUBWSUVQB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |