About 1-hydroxy-2,4-dimethyl-2,3-dihydroindene-1-carboxylic acid
1-hydroxy-2,4-dimethyl-2,3-dihydroindene-1-carboxylic acid (PubChem CID 112715912) has the molecular formula C12H14O3
and a molecular weight of 206.24 g/mol. Its IUPAC name is 1-hydroxy-2,4-dimethyl-2,3-dihydroindene-1-carboxylic acid.
Analyze 1-hydroxy-2,4-dimethyl-2,3-dihydroindene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-hydroxy-2,4-dimethyl-2,3-dihydroindene-1-carboxylic acid?
The IUPAC name of 1-hydroxy-2,4-dimethyl-2,3-dihydroindene-1-carboxylic acid (CID 112715912) is 1-hydroxy-2,4-dimethyl-2,3-dihydroindene-1-carboxylic acid.
What is the SMILES notation for 1-hydroxy-2,4-dimethyl-2,3-dihydroindene-1-carboxylic acid?
The canonical SMILES for 1-hydroxy-2,4-dimethyl-2,3-dihydroindene-1-carboxylic acid is Cc1cccc2c1CC(C)C2(O)C(=O)O.
What is the InChIKey of 1-hydroxy-2,4-dimethyl-2,3-dihydroindene-1-carboxylic acid?
The InChIKey is WHGGDIYKYRYIHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O3/c1-7-4-3-5-10-9(7)6-8(2)12(10,15)11(13)14/h3-5,8,15H,6H2,1-2H3,(H,13,14).
What are the key properties of 1-hydroxy-2,4-dimethyl-2,3-dihydroindene-1-carboxylic acid?
1-hydroxy-2,4-dimethyl-2,3-dihydroindene-1-carboxylic acid has a molecular weight of 206.24 g/mol, XLogP of 1.46, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-hydroxy-2,4-dimethyl-2,3-dihydroindene-1-carboxylic acid is sourced from PubChem (CID 112715912), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).