C18H24O3 — CID 139760976
2,3-dimethyl-1-[2-(2,4,6-trimethylphenyl)acetyl]cyclobutane-1-carboxylic acid (PubChem CID 139760976) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is 2,3-dimethyl-1-[2-(2,4,6-trimethylphenyl)acetyl]cyclobutane-1-carboxylic acid.
| Compound Name | 2,3-dimethyl-1-[2-(2,4,6-trimethylphenyl)acetyl]cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 139760976 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 2,3-dimethyl-1-[2-(2,4,6-trimethylphenyl)acetyl]cyclobutane-1-carboxylic acid |
| SMILES | Cc1cc(C)c(CC(=O)C2(C(=O)O)CC(C)C2C)c(C)c1 |
| InChI | InChI=1S/C18H24O3/c1-10-6-11(2)15(12(3)7-10)8-16(19)18(17(20)21)9-13(4)14(18)5/h6-7,13-14H,8-9H2,1-5H3,(H,20,21) |
| InChIKey | ROUFRDBCHAINFA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|