C17H22F2O — CID 105085826
1-(4,4-difluorocyclohexyl)-2-(2,4,6-trimethylphenyl)ethanone (PubChem CID 105085826) has the molecular formula C17H22F2O and a molecular weight of 280.36 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-2-(2,4,6-trimethylphenyl)ethanone.
| Compound Name | 1-(4,4-difluorocyclohexyl)-2-(2,4,6-trimethylphenyl)ethanone |
|---|---|
| PubChem CID | 105085826 |
| Molecular Formula | C17H22F2O |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-2-(2,4,6-trimethylphenyl)ethanone |
| SMILES | Cc1cc(C)c(CC(=O)C2CCC(F)(F)CC2)c(C)c1 |
| InChI | InChI=1S/C17H22F2O/c1-11-8-12(2)15(13(3)9-11)10-16(20)14-4-6-17(18,19)7-5-14/h8-9,14H,4-7,10H2,1-3H3 |
| InChIKey | QOXWTJFPDAFXDI-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |