C14H14Cl2F2O — CID 105086176
2-(2,6-dichlorophenyl)-1-(4,4-difluorocyclohexyl)ethanone (PubChem CID 105086176) has the molecular formula C14H14Cl2F2O and a molecular weight of 307.17 g/mol. Its IUPAC name is 2-(2,6-dichlorophenyl)-1-(4,4-difluorocyclohexyl)ethanone.
| Compound Name | 2-(2,6-dichlorophenyl)-1-(4,4-difluorocyclohexyl)ethanone |
|---|---|
| PubChem CID | 105086176 |
| Molecular Formula | C14H14Cl2F2O |
| Molecular Weight | 307.17 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | 2-(2,6-dichlorophenyl)-1-(4,4-difluorocyclohexyl)ethanone |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C14H14Cl2F2O/c15-11-2-1-3-12(16)10(11)8-13(19)9-4-6-14(17,18)7-5-9/h1-3,9H,4-8H2 |
| InChIKey | FPTKYPRPBQIEFF-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.17 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |