C12H16F2N2O — CID 105123784
1-(4,4-difluorocyclohexyl)-2-(1-methylpyrazol-3-yl)ethanone (PubChem CID 105123784) has the molecular formula C12H16F2N2O and a molecular weight of 242.27 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-2-(1-methylpyrazol-3-yl)ethanone.
| Compound Name | 1-(4,4-difluorocyclohexyl)-2-(1-methylpyrazol-3-yl)ethanone |
|---|---|
| PubChem CID | 105123784 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-2-(1-methylpyrazol-3-yl)ethanone |
| SMILES | Cn1ccc(CC(=O)C2CCC(F)(F)CC2)n1 |
| InChI | InChI=1S/C12H16F2N2O/c1-16-7-4-10(15-16)8-11(17)9-2-5-12(13,14)6-3-9/h4,7,9H,2-3,5-6,8H2,1H3 |
| InChIKey | LXWRUMNQVYFUNK-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |