C13H18F2N2O — CID 105115196
1-(4,4-difluorocyclohexyl)-2-(1-ethylimidazol-2-yl)ethanone (PubChem CID 105115196) has the molecular formula C13H18F2N2O and a molecular weight of 256.30 g/mol. Its IUPAC name is 1-(4,4-difluorocyclohexyl)-2-(1-ethylimidazol-2-yl)ethanone.
| Compound Name | 1-(4,4-difluorocyclohexyl)-2-(1-ethylimidazol-2-yl)ethanone |
|---|---|
| PubChem CID | 105115196 |
| Molecular Formula | C13H18F2N2O |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 1-(4,4-difluorocyclohexyl)-2-(1-ethylimidazol-2-yl)ethanone |
| SMILES | CCn1ccnc1CC(=O)C1CCC(F)(F)CC1 |
| InChI | InChI=1S/C13H18F2N2O/c1-2-17-8-7-16-12(17)9-11(18)10-3-5-13(14,15)6-4-10/h7-8,10H,2-6,9H2,1H3 |
| InChIKey | GGYMPHWPZGDKEQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |