C16H20O2 — CID 70255999
2-[2-(2,4,6-trimethylphenyl)acetyl]cyclopentan-1-one (PubChem CID 70255999) has the molecular formula C16H20O2 and a molecular weight of 244.33 g/mol. Its IUPAC name is 2-[2-(2,4,6-trimethylphenyl)acetyl]cyclopentan-1-one.
| Compound Name | 2-[2-(2,4,6-trimethylphenyl)acetyl]cyclopentan-1-one |
|---|---|
| PubChem CID | 70255999 |
| Molecular Formula | C16H20O2 |
| Molecular Weight | 244.33 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | 2-[2-(2,4,6-trimethylphenyl)acetyl]cyclopentan-1-one |
| SMILES | Cc1cc(C)c(CC(=O)C2CCCC2=O)c(C)c1 |
| InChI | InChI=1S/C16H20O2/c1-10-7-11(2)14(12(3)8-10)9-16(18)13-5-4-6-15(13)17/h7-8,13H,4-6,9H2,1-3H3 |
| InChIKey | QOGDHDDHFMGMHE-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|