C18H24O3 — CID 67668185
methyl 1-[2-(2,4,6-trimethylphenyl)acetyl]cyclopentane-1-carboxylate (PubChem CID 67668185) has the molecular formula C18H24O3 and a molecular weight of 288.39 g/mol. Its IUPAC name is methyl 1-[2-(2,4,6-trimethylphenyl)acetyl]cyclopentane-1-carboxylate.
| Compound Name | methyl 1-[2-(2,4,6-trimethylphenyl)acetyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 67668185 |
| Molecular Formula | C18H24O3 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | methyl 1-[2-(2,4,6-trimethylphenyl)acetyl]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(C(=O)Cc2c(C)cc(C)cc2C)CCCC1 |
| InChI | InChI=1S/C18H24O3/c1-12-9-13(2)15(14(3)10-12)11-16(19)18(17(20)21-4)7-5-6-8-18/h9-10H,5-8,11H2,1-4H3 |
| InChIKey | SYDSLGFRFQFPIN-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|