methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate

C15H20O3 — CID 116930223

IUPACmethyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate
SMILESCOC(=O)C1(Cc2c(C)cc(C)cc2C)COC1
InChIInChI=1S/C15H20O3/c1-10-5-11(2)13(12(3)6-10)7-15(8-18-9-15)14(16)17-4/h5-6H,7-9H2,1-4H3
InChIKeyFGCSZHVNKAJNOW-UHFFFAOYSA-N
MW248.32 g/mol
LogP2.34
Rot. Bonds3

About methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate

methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate (PubChem CID 116930223) has the molecular formula C15H20O3 and a molecular weight of 248.32 g/mol. Its IUPAC name is methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate.

Molecular Properties

Compound Namemethyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate
PubChem CID116930223
Molecular FormulaC15H20O3
Molecular Weight248.32 g/mol
Exact Mass248.14
IUPAC Namemethyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate
SMILESCOC(=O)C1(Cc2c(C)cc(C)cc2C)COC1
InChIInChI=1S/C15H20O3/c1-10-5-11(2)13(12(3)6-10)7-15(8-18-9-15)14(16)17-4/h5-6H,7-9H2,1-4H3
InChIKeyFGCSZHVNKAJNOW-UHFFFAOYSA-N
XLogP2.34
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.32
LogP ≤ 52.34
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate?
The IUPAC name of methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate (CID 116930223) is methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate.
What is the SMILES notation for methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate?
The canonical SMILES for methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate is COC(=O)C1(Cc2c(C)cc(C)cc2C)COC1.
What is the InChIKey of methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate?
The InChIKey is FGCSZHVNKAJNOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3/c1-10-5-11(2)13(12(3)6-10)7-15(8-18-9-15)14(16)17-4/h5-6H,7-9H2,1-4H3.
What are the key properties of methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate?
methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate has a molecular weight of 248.32 g/mol, XLogP of 2.34, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate is sourced from PubChem (CID 116930223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).