About methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate
methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate (PubChem CID 116930223) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate.
Analyze methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate?
The IUPAC name of methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate (CID 116930223) is methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate.
What is the SMILES notation for methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate?
The canonical SMILES for methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate is COC(=O)C1(Cc2c(C)cc(C)cc2C)COC1.
What is the InChIKey of methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate?
The InChIKey is FGCSZHVNKAJNOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O3/c1-10-5-11(2)13(12(3)6-10)7-15(8-18-9-15)14(16)17-4/h5-6H,7-9H2,1-4H3.
What are the key properties of methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate?
methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate has a molecular weight of 248.32 g/mol, XLogP of 2.34, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[(2,4,6-trimethylphenyl)methyl]oxetane-3-carboxylate is sourced from PubChem (CID 116930223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).