C17H22O5 — CID 67668004
3,4-dihydroxy-1-[2-(2,4,6-trimethylphenyl)acetyl]cyclopentane-1-carboxylic acid (PubChem CID 67668004) has the molecular formula C17H22O5 and a molecular weight of 306.36 g/mol. Its IUPAC name is 3,4-dihydroxy-1-[2-(2,4,6-trimethylphenyl)acetyl]cyclopentane-1-carboxylic acid.
| Compound Name | 3,4-dihydroxy-1-[2-(2,4,6-trimethylphenyl)acetyl]cyclopentane-1-carboxylic acid |
|---|---|
| PubChem CID | 67668004 |
| Molecular Formula | C17H22O5 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 3,4-dihydroxy-1-[2-(2,4,6-trimethylphenyl)acetyl]cyclopentane-1-carboxylic acid |
| SMILES | Cc1cc(C)c(CC(=O)C2(C(=O)O)CC(O)C(O)C2)c(C)c1 |
| InChI | InChI=1S/C17H22O5/c1-9-4-10(2)12(11(3)5-9)6-15(20)17(16(21)22)7-13(18)14(19)8-17/h4-5,13-14,18-19H,6-8H2,1-3H3,(H,21,22) |
| InChIKey | CRIOJLNLZBHMFY-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|