C10H12O2S — CID 84774040
1-(4-methylthiophen-3-yl)cyclobutane-1-carboxylic acid (PubChem CID 84774040) has the molecular formula C10H12O2S and a molecular weight of 196.27 g/mol. Its IUPAC name is 1-(4-methylthiophen-3-yl)cyclobutane-1-carboxylic acid.
| Compound Name | 1-(4-methylthiophen-3-yl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 84774040 |
| Molecular Formula | C10H12O2S |
| Molecular Weight | 196.27 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 1-(4-methylthiophen-3-yl)cyclobutane-1-carboxylic acid |
| SMILES | Cc1cscc1C1(C(=O)O)CCC1 |
| InChI | InChI=1S/C10H12O2S/c1-7-5-13-6-8(7)10(9(11)12)3-2-4-10/h5-6H,2-4H2,1H3,(H,11,12) |
| InChIKey | CXGYGAMPTRASIT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.27 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |