C15H20O4 — CID 117415085
1-(2-hydroxy-5-methoxy-3-methylphenyl)cyclohexane-1-carboxylic acid (PubChem CID 117415085) has the molecular formula C15H20O4 and a molecular weight of 264.32 g/mol. Its IUPAC name is 1-(2-hydroxy-5-methoxy-3-methylphenyl)cyclohexane-1-carboxylic acid.
| Compound Name | 1-(2-hydroxy-5-methoxy-3-methylphenyl)cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 117415085 |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 1-(2-hydroxy-5-methoxy-3-methylphenyl)cyclohexane-1-carboxylic acid |
| SMILES | COc1cc(C)c(O)c(C2(C(=O)O)CCCCC2)c1 |
| InChI | InChI=1S/C15H20O4/c1-10-8-11(19-2)9-12(13(10)16)15(14(17)18)6-4-3-5-7-15/h8-9,16H,3-7H2,1-2H3,(H,17,18) |
| InChIKey | GYIZOHKGZCYPQY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |