C12H14N2O5 — CID 106702274
4-(2-amino-5-nitrophenyl)oxane-4-carboxylic acid (PubChem CID 106702274) has the molecular formula C12H14N2O5 and a molecular weight of 266.25 g/mol. Its IUPAC name is 4-(2-amino-5-nitrophenyl)oxane-4-carboxylic acid.
| Compound Name | 4-(2-amino-5-nitrophenyl)oxane-4-carboxylic acid |
|---|---|
| PubChem CID | 106702274 |
| Molecular Formula | C12H14N2O5 |
| Molecular Weight | 266.25 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 4-(2-amino-5-nitrophenyl)oxane-4-carboxylic acid |
| SMILES | Nc1ccc([N+](=O)[O-])cc1C1(C(=O)O)CCOCC1 |
| InChI | InChI=1S/C12H14N2O5/c13-10-2-1-8(14(17)18)7-9(10)12(11(15)16)3-5-19-6-4-12/h1-2,7H,3-6,13H2,(H,15,16) |
| InChIKey | NBPLMYULMFIDBW-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 115.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|