C21H11N3O8 — CID 140911073
4,12,17-trinitropentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene-1-carboxylic acid (PubChem CID 140911073) has the molecular formula C21H11N3O8 and a molecular weight of 433.33 g/mol. Its IUPAC name is 4,12,17-trinitropentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene-1-carboxylic acid.
| Compound Name | 4,12,17-trinitropentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene-1-carboxylic acid |
|---|---|
| PubChem CID | 140911073 |
| Molecular Formula | C21H11N3O8 |
| Molecular Weight | 433.33 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | 4,12,17-trinitropentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaene-1-carboxylic acid |
| SMILES | O=C(O)C12c3cc([N+](=O)[O-])ccc3C(c3ccc([N+](=O)[O-])cc31)c1ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C21H11N3O8/c25-20(26)21-16-7-10(22(27)28)1-4-13(16)19(14-5-2-11(23(29)30)8-17(14)21)15-6-3-12(24(31)32)9-18(15)21/h1-9,19H,(H,25,26) |
| InChIKey | NQCVUZGRRJTJBA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 166.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.33 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|