C16H10N2O9 — CID 87672796
(2S,3S)-2,3-bis(4-nitrophenyl)oxirane-2,3-dicarboxylic acid (PubChem CID 87672796) has the molecular formula C16H10N2O9 and a molecular weight of 374.26 g/mol. Its IUPAC name is (2S,3S)-2,3-bis(4-nitrophenyl)oxirane-2,3-dicarboxylic acid.
| Compound Name | (2S,3S)-2,3-bis(4-nitrophenyl)oxirane-2,3-dicarboxylic acid |
|---|---|
| PubChem CID | 87672796 |
| Molecular Formula | C16H10N2O9 |
| Molecular Weight | 374.26 g/mol |
| Exact Mass | 374.04 |
| IUPAC Name | (2S,3S)-2,3-bis(4-nitrophenyl)oxirane-2,3-dicarboxylic acid |
| SMILES | O=C(O)[C@@]1(c2ccc([N+](=O)[O-])cc2)O[C@@]1(C(=O)O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H10N2O9/c19-13(20)15(9-1-5-11(6-2-9)17(23)24)16(27-15,14(21)22)10-3-7-12(8-4-10)18(25)26/h1-8H,(H,19,20)(H,21,22)/t15-,16-/m1/s1 |
| InChIKey | AIIZDNMQHOITBK-HZPDHXFCSA-N |
| XLogP | 1.79 |
| TPSA | 173.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.26 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|