C17H11N3O4 — CID 15206070
4,12-dinitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-1-carbonitrile (PubChem CID 15206070) has the molecular formula C17H11N3O4 and a molecular weight of 321.29 g/mol. Its IUPAC name is 4,12-dinitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-1-carbonitrile.
| Compound Name | 4,12-dinitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-1-carbonitrile |
|---|---|
| PubChem CID | 15206070 |
| Molecular Formula | C17H11N3O4 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 4,12-dinitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9(14),10,12-hexaene-1-carbonitrile |
| SMILES | N#CC12CCC(c3ccc([N+](=O)[O-])cc31)c1ccc([N+](=O)[O-])cc12 |
| InChI | InChI=1S/C17H11N3O4/c18-9-17-6-5-12(13-3-1-10(19(21)22)7-15(13)17)14-4-2-11(20(23)24)8-16(14)17/h1-4,7-8,12H,5-6H2 |
| InChIKey | MRYVMDVLENBLGT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 110.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|