C16H11I2NO2 — CID 15205272
1,8-diiodo-4-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene (PubChem CID 15205272) has the molecular formula C16H11I2NO2 and a molecular weight of 503.08 g/mol. Its IUPAC name is 1,8-diiodo-4-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene.
| Compound Name | 1,8-diiodo-4-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene |
|---|---|
| PubChem CID | 15205272 |
| Molecular Formula | C16H11I2NO2 |
| Molecular Weight | 503.08 g/mol |
| Exact Mass | 502.89 |
| IUPAC Name | 1,8-diiodo-4-nitrotetracyclo[6.6.2.02,7.09,14]hexadeca-2(7),3,5,9,11,13-hexaene |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C1(I)CCC2(I)c2ccccc21 |
| InChI | InChI=1S/C16H11I2NO2/c17-15-7-8-16(18,12-4-2-1-3-11(12)15)14-9-10(19(20)21)5-6-13(14)15/h1-6,9H,7-8H2 |
| InChIKey | URYKUHMJIHTDPH-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.08 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|