C11H12N2O2 — CID 155644504
6-nitrospiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclopropane] (PubChem CID 155644504) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is 6-nitrospiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclopropane].
| Compound Name | 6-nitrospiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclopropane] |
|---|---|
| PubChem CID | 155644504 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | 6-nitrospiro[2,3-dihydro-1H-isoquinoline-4,1'-cyclopropane] |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C1(CC1)CNC2 |
| InChI | InChI=1S/C11H12N2O2/c14-13(15)9-2-1-8-6-12-7-11(3-4-11)10(8)5-9/h1-2,5,12H,3-4,6-7H2 |
| InChIKey | YXCVJLPQDIBXFL-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|