C11H12N2O3 — CID 106701917
5-nitrospiro[1,2-dihydroindole-3,3'-oxolane] (PubChem CID 106701917) has the molecular formula C11H12N2O3 and a molecular weight of 220.23 g/mol. Its IUPAC name is 5-nitrospiro[1,2-dihydroindole-3,3'-oxolane].
| Compound Name | 5-nitrospiro[1,2-dihydroindole-3,3'-oxolane] |
|---|---|
| PubChem CID | 106701917 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 5-nitrospiro[1,2-dihydroindole-3,3'-oxolane] |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C1(CCOC1)CN2 |
| InChI | InChI=1S/C11H12N2O3/c14-13(15)8-1-2-10-9(5-8)11(6-12-10)3-4-16-7-11/h1-2,5,12H,3-4,6-7H2 |
| InChIKey | KYVAGJNMMZRDDE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|