C8H9N3O2 — CID 67278398
1-methyl-6-nitro-2,3-dihydroindazole (PubChem CID 67278398) has the molecular formula C8H9N3O2 and a molecular weight of 179.18 g/mol. Its IUPAC name is 1-methyl-6-nitro-2,3-dihydroindazole.
| Compound Name | 1-methyl-6-nitro-2,3-dihydroindazole |
|---|---|
| PubChem CID | 67278398 |
| Molecular Formula | C8H9N3O2 |
| Molecular Weight | 179.18 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 1-methyl-6-nitro-2,3-dihydroindazole |
| SMILES | CN1NCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C8H9N3O2/c1-10-8-4-7(11(12)13)3-2-6(8)5-9-10/h2-4,9H,5H2,1H3 |
| InChIKey | IQEQQLAGJQSBAF-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.18 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|