C10H12N2O4S — CID 110287378
1-ethylsulfonyl-6-nitro-2,3-dihydroindole (PubChem CID 110287378) has the molecular formula C10H12N2O4S and a molecular weight of 256.28 g/mol. Its IUPAC name is 1-ethylsulfonyl-6-nitro-2,3-dihydroindole.
| Compound Name | 1-ethylsulfonyl-6-nitro-2,3-dihydroindole |
|---|---|
| PubChem CID | 110287378 |
| Molecular Formula | C10H12N2O4S |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 1-ethylsulfonyl-6-nitro-2,3-dihydroindole |
| SMILES | CCS(=O)(=O)N1CCc2ccc([N+](=O)[O-])cc21 |
| InChI | InChI=1S/C10H12N2O4S/c1-2-17(15,16)11-6-5-8-3-4-9(12(13)14)7-10(8)11/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | SFQCWXIVJIFCSC-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|