C18H17N3O5S — CID 110427320
1-methyl-6-[(6-nitro-2,3-dihydroindol-1-yl)sulfonyl]-3,4-dihydroquinolin-2-one (PubChem CID 110427320) has the molecular formula C18H17N3O5S and a molecular weight of 387.42 g/mol. Its IUPAC name is 1-methyl-6-[(6-nitro-2,3-dihydroindol-1-yl)sulfonyl]-3,4-dihydroquinolin-2-one.
| Compound Name | 1-methyl-6-[(6-nitro-2,3-dihydroindol-1-yl)sulfonyl]-3,4-dihydroquinolin-2-one |
|---|---|
| PubChem CID | 110427320 |
| Molecular Formula | C18H17N3O5S |
| Molecular Weight | 387.42 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | 1-methyl-6-[(6-nitro-2,3-dihydroindol-1-yl)sulfonyl]-3,4-dihydroquinolin-2-one |
| SMILES | CN1C(=O)CCc2cc(S(=O)(=O)N3CCc4ccc([N+](=O)[O-])cc43)ccc21 |
| InChI | InChI=1S/C18H17N3O5S/c1-19-16-6-5-15(10-13(16)3-7-18(19)22)27(25,26)20-9-8-12-2-4-14(21(23)24)11-17(12)20/h2,4-6,10-11H,3,7-9H2,1H3 |
| InChIKey | LLMKUXNXMLTXKG-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 100.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.42 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|