C18H12Cl2N4O5S — CID 31535113
4,5-dichloro-2-[4-[(6-nitro-2,3-dihydroindol-1-yl)sulfonyl]phenyl]pyridazin-3-one (PubChem CID 31535113) has the molecular formula C18H12Cl2N4O5S and a molecular weight of 467.29 g/mol. Its IUPAC name is 4,5-dichloro-2-[4-[(6-nitro-2,3-dihydroindol-1-yl)sulfonyl]phenyl]pyridazin-3-one.
| Compound Name | 4,5-dichloro-2-[4-[(6-nitro-2,3-dihydroindol-1-yl)sulfonyl]phenyl]pyridazin-3-one |
|---|---|
| PubChem CID | 31535113 |
| Molecular Formula | C18H12Cl2N4O5S |
| Molecular Weight | 467.29 g/mol |
| Exact Mass | 465.99 |
| IUPAC Name | 4,5-dichloro-2-[4-[(6-nitro-2,3-dihydroindol-1-yl)sulfonyl]phenyl]pyridazin-3-one |
| SMILES | O=c1c(Cl)c(Cl)cnn1-c1ccc(S(=O)(=O)N2CCc3ccc([N+](=O)[O-])cc32)cc1 |
| InChI | InChI=1S/C18H12Cl2N4O5S/c19-15-10-21-23(18(25)17(15)20)12-3-5-14(6-4-12)30(28,29)22-8-7-11-1-2-13(24(26)27)9-16(11)22/h1-6,9-10H,7-8H2 |
| InChIKey | ZZHKKGWFUZNFNN-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 115.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|