C16H15FN2O5S — CID 110306404
1-[2-(4-fluorophenoxy)ethylsulfonyl]-6-nitro-2,3-dihydroindole (PubChem CID 110306404) has the molecular formula C16H15FN2O5S and a molecular weight of 366.37 g/mol. Its IUPAC name is 1-[2-(4-fluorophenoxy)ethylsulfonyl]-6-nitro-2,3-dihydroindole.
| Compound Name | 1-[2-(4-fluorophenoxy)ethylsulfonyl]-6-nitro-2,3-dihydroindole |
|---|---|
| PubChem CID | 110306404 |
| Molecular Formula | C16H15FN2O5S |
| Molecular Weight | 366.37 g/mol |
| Exact Mass | 366.07 |
| IUPAC Name | 1-[2-(4-fluorophenoxy)ethylsulfonyl]-6-nitro-2,3-dihydroindole |
| SMILES | O=[N+]([O-])c1ccc2c(c1)N(S(=O)(=O)CCOc1ccc(F)cc1)CC2 |
| InChI | InChI=1S/C16H15FN2O5S/c17-13-2-5-15(6-3-13)24-9-10-25(22,23)18-8-7-12-1-4-14(19(20)21)11-16(12)18/h1-6,11H,7-10H2 |
| InChIKey | RMSOBASYRUPIJA-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|