C12H17FN2O2S — CID 103504259
3-[(6-fluoro-2,3-dihydroindol-1-yl)sulfonyl]-N-methylpropan-1-amine (PubChem CID 103504259) has the molecular formula C12H17FN2O2S and a molecular weight of 272.34 g/mol. Its IUPAC name is 3-[(6-fluoro-2,3-dihydroindol-1-yl)sulfonyl]-N-methylpropan-1-amine.
| Compound Name | 3-[(6-fluoro-2,3-dihydroindol-1-yl)sulfonyl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 103504259 |
| Molecular Formula | C12H17FN2O2S |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 3-[(6-fluoro-2,3-dihydroindol-1-yl)sulfonyl]-N-methylpropan-1-amine |
| SMILES | CNCCCS(=O)(=O)N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C12H17FN2O2S/c1-14-6-2-8-18(16,17)15-7-5-10-3-4-11(13)9-12(10)15/h3-4,9,14H,2,5-8H2,1H3 |
| InChIKey | MHSFIENIPGXHCN-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|