C12H17FN2O2S — CID 103495190
2-[(6-fluoro-2,3-dihydroindol-1-yl)sulfonyl]butan-1-amine (PubChem CID 103495190) has the molecular formula C12H17FN2O2S and a molecular weight of 272.34 g/mol. Its IUPAC name is 2-[(6-fluoro-2,3-dihydroindol-1-yl)sulfonyl]butan-1-amine.
| Compound Name | 2-[(6-fluoro-2,3-dihydroindol-1-yl)sulfonyl]butan-1-amine |
|---|---|
| PubChem CID | 103495190 |
| Molecular Formula | C12H17FN2O2S |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 2-[(6-fluoro-2,3-dihydroindol-1-yl)sulfonyl]butan-1-amine |
| SMILES | CCC(CN)S(=O)(=O)N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C12H17FN2O2S/c1-2-11(8-14)18(16,17)15-6-5-9-3-4-10(13)7-12(9)15/h3-4,7,11H,2,5-6,8,14H2,1H3 |
| InChIKey | AQJZLTDUWAEUGI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |