C10H13FN2O2S — CID 103495195
2-[(6-fluoro-2,3-dihydroindol-1-yl)sulfonyl]ethanamine (PubChem CID 103495195) has the molecular formula C10H13FN2O2S and a molecular weight of 244.29 g/mol. Its IUPAC name is 2-[(6-fluoro-2,3-dihydroindol-1-yl)sulfonyl]ethanamine.
| Compound Name | 2-[(6-fluoro-2,3-dihydroindol-1-yl)sulfonyl]ethanamine |
|---|---|
| PubChem CID | 103495195 |
| Molecular Formula | C10H13FN2O2S |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 2-[(6-fluoro-2,3-dihydroindol-1-yl)sulfonyl]ethanamine |
| SMILES | NCCS(=O)(=O)N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C10H13FN2O2S/c11-9-2-1-8-3-5-13(10(8)7-9)16(14,15)6-4-12/h1-2,7H,3-6,12H2 |
| InChIKey | LQCMWOAGAJPBKG-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |