C13H11ClFNO2S2 — CID 103504169
1-[2-(chloromethyl)thiophen-3-yl]sulfonyl-6-fluoro-2,3-dihydroindole (PubChem CID 103504169) has the molecular formula C13H11ClFNO2S2 and a molecular weight of 331.82 g/mol. Its IUPAC name is 1-[2-(chloromethyl)thiophen-3-yl]sulfonyl-6-fluoro-2,3-dihydroindole.
| Compound Name | 1-[2-(chloromethyl)thiophen-3-yl]sulfonyl-6-fluoro-2,3-dihydroindole |
|---|---|
| PubChem CID | 103504169 |
| Molecular Formula | C13H11ClFNO2S2 |
| Molecular Weight | 331.82 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 1-[2-(chloromethyl)thiophen-3-yl]sulfonyl-6-fluoro-2,3-dihydroindole |
| SMILES | O=S(=O)(c1ccsc1CCl)N1CCc2ccc(F)cc21 |
| InChI | InChI=1S/C13H11ClFNO2S2/c14-8-12-13(4-6-19-12)20(17,18)16-5-3-9-1-2-10(15)7-11(9)16/h1-2,4,6-7H,3,5,8H2 |
| InChIKey | QZCJWVCGBJXWHV-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.82 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|