C18H19N3O5 — CID 19872056
7-nitro-3-[2-(4-nitrophenoxy)ethyl]-1,2,4,5-tetrahydro-3-benzazepine (PubChem CID 19872056) has the molecular formula C18H19N3O5 and a molecular weight of 357.37 g/mol. Its IUPAC name is 7-nitro-3-[2-(4-nitrophenoxy)ethyl]-1,2,4,5-tetrahydro-3-benzazepine.
| Compound Name | 7-nitro-3-[2-(4-nitrophenoxy)ethyl]-1,2,4,5-tetrahydro-3-benzazepine |
|---|---|
| PubChem CID | 19872056 |
| Molecular Formula | C18H19N3O5 |
| Molecular Weight | 357.37 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 7-nitro-3-[2-(4-nitrophenoxy)ethyl]-1,2,4,5-tetrahydro-3-benzazepine |
| SMILES | O=[N+]([O-])c1ccc(OCCN2CCc3ccc([N+](=O)[O-])cc3CC2)cc1 |
| InChI | InChI=1S/C18H19N3O5/c22-20(23)16-3-5-18(6-4-16)26-12-11-19-9-7-14-1-2-17(21(24)25)13-15(14)8-10-19/h1-6,13H,7-12H2 |
| InChIKey | DJXPMFQHJADFSC-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|