C34H36N4O6 — CID 160987946
6-methoxy-2-[(4-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinoline;7-methoxy-2-[(4-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinoline (PubChem CID 160987946) has the molecular formula C34H36N4O6 and a molecular weight of 596.68 g/mol. Its IUPAC name is 6-methoxy-2-[(4-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinoline;7-methoxy-2-[(4-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinoline.
| Compound Name | 6-methoxy-2-[(4-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinoline;7-methoxy-2-[(4-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 160987946 |
| Molecular Formula | C34H36N4O6 |
| Molecular Weight | 596.68 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | 6-methoxy-2-[(4-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinoline;7-methoxy-2-[(4-nitrophenyl)methyl]-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1ccc2c(c1)CCN(Cc1ccc([N+](=O)[O-])cc1)C2.COc1ccc2c(c1)CN(Cc1ccc([N+](=O)[O-])cc1)CC2 |
| InChI | InChI=1S/2C17H18N2O3/c1-22-17-7-4-15-12-18(9-8-14(15)10-17)11-13-2-5-16(6-3-13)19(20)21;1-22-17-7-4-14-8-9-18(12-15(14)10-17)11-13-2-5-16(6-3-13)19(20)21/h2*2-7,10H,8-9,11-12H2,1H3 |
| InChIKey | TUFNBDRTKYTHFG-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 111.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.68 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|