C12H17N2O2+ — CID 69140709
3,3-dimethyl-7-nitro-1,2,4,5-tetrahydro-3-benzazepin-3-ium (PubChem CID 69140709) has the molecular formula C12H17N2O2+ and a molecular weight of 221.28 g/mol. Its IUPAC name is 3,3-dimethyl-7-nitro-1,2,4,5-tetrahydro-3-benzazepin-3-ium.
| Compound Name | 3,3-dimethyl-7-nitro-1,2,4,5-tetrahydro-3-benzazepin-3-ium |
|---|---|
| PubChem CID | 69140709 |
| Molecular Formula | C12H17N2O2+ |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 3,3-dimethyl-7-nitro-1,2,4,5-tetrahydro-3-benzazepin-3-ium |
| SMILES | C[N+]1(C)CCc2ccc([N+](=O)[O-])cc2CC1 |
| InChI | InChI=1S/C12H17N2O2/c1-14(2)7-5-10-3-4-12(13(15)16)9-11(10)6-8-14/h3-4,9H,5-8H2,1-2H3/q+1 |
| InChIKey | JSPUKFCOVCQQAI-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|