C12H15NO2 — CID 13463290
4,4-dimethyl-7-nitro-2,3-dihydro-1H-naphthalene (PubChem CID 13463290) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 4,4-dimethyl-7-nitro-2,3-dihydro-1H-naphthalene.
| Compound Name | 4,4-dimethyl-7-nitro-2,3-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 13463290 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 4,4-dimethyl-7-nitro-2,3-dihydro-1H-naphthalene |
| SMILES | CC1(C)CCCc2cc([N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C12H15NO2/c1-12(2)7-3-4-9-8-10(13(14)15)5-6-11(9)12/h5-6,8H,3-4,7H2,1-2H3 |
| InChIKey | QXWYXVHBCXPTOP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|