C13H17NO3 — CID 10263473
7-methoxy-4,4-dimethyl-6-nitro-2,3-dihydro-1H-naphthalene (PubChem CID 10263473) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 7-methoxy-4,4-dimethyl-6-nitro-2,3-dihydro-1H-naphthalene.
| Compound Name | 7-methoxy-4,4-dimethyl-6-nitro-2,3-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 10263473 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 7-methoxy-4,4-dimethyl-6-nitro-2,3-dihydro-1H-naphthalene |
| SMILES | COc1cc2c(cc1[N+](=O)[O-])C(C)(C)CCC2 |
| InChI | InChI=1S/C13H17NO3/c1-13(2)6-4-5-9-7-12(17-3)11(14(15)16)8-10(9)13/h7-8H,4-6H2,1-3H3 |
| InChIKey | LUTDYDASZQIMFL-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|