C13H18N2O3 — CID 164568695
6-methoxy-2,4,4-trimethyl-7-nitro-1,3-dihydroisoquinoline (PubChem CID 164568695) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is 6-methoxy-2,4,4-trimethyl-7-nitro-1,3-dihydroisoquinoline.
| Compound Name | 6-methoxy-2,4,4-trimethyl-7-nitro-1,3-dihydroisoquinoline |
|---|---|
| PubChem CID | 164568695 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | 6-methoxy-2,4,4-trimethyl-7-nitro-1,3-dihydroisoquinoline |
| SMILES | COc1cc2c(cc1[N+](=O)[O-])CN(C)CC2(C)C |
| InChI | InChI=1S/C13H18N2O3/c1-13(2)8-14(3)7-9-5-11(15(16)17)12(18-4)6-10(9)13/h5-6H,7-8H2,1-4H3 |
| InChIKey | BGMVCNZYGALOTB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|