C15H18N2O4 — CID 86661698
7-methoxy-1'-methyl-6-nitrospiro[chromene-2,4'-piperidine] (PubChem CID 86661698) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 7-methoxy-1'-methyl-6-nitrospiro[chromene-2,4'-piperidine].
| Compound Name | 7-methoxy-1'-methyl-6-nitrospiro[chromene-2,4'-piperidine] |
|---|---|
| PubChem CID | 86661698 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 7-methoxy-1'-methyl-6-nitrospiro[chromene-2,4'-piperidine] |
| SMILES | COc1cc2c(cc1[N+](=O)[O-])C=CC1(CCN(C)CC1)O2 |
| InChI | InChI=1S/C15H18N2O4/c1-16-7-5-15(6-8-16)4-3-11-9-12(17(18)19)14(20-2)10-13(11)21-15/h3-4,9-10H,5-8H2,1-2H3 |
| InChIKey | LTDKWVZWDUTBFY-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|