C16H22N2O2 — CID 82046777
2-(6-methoxyspiro[chromene-2,4'-piperidine]-1'-yl)ethanamine (PubChem CID 82046777) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is 2-(6-methoxyspiro[chromene-2,4'-piperidine]-1'-yl)ethanamine.
| Compound Name | 2-(6-methoxyspiro[chromene-2,4'-piperidine]-1'-yl)ethanamine |
|---|---|
| PubChem CID | 82046777 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 2-(6-methoxyspiro[chromene-2,4'-piperidine]-1'-yl)ethanamine |
| SMILES | COc1ccc2c(c1)C=CC1(CCN(CCN)CC1)O2 |
| InChI | InChI=1S/C16H22N2O2/c1-19-14-2-3-15-13(12-14)4-5-16(20-15)6-9-18(10-7-16)11-8-17/h2-5,12H,6-11,17H2,1H3 |
| InChIKey | KCPZOSUXLJBVGH-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 47.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |