C17H21NO4 — CID 82046695
2-(7-ethoxyspiro[chromene-2,4'-piperidine]-1'-yl)acetic acid (PubChem CID 82046695) has the molecular formula C17H21NO4 and a molecular weight of 303.36 g/mol. Its IUPAC name is 2-(7-ethoxyspiro[chromene-2,4'-piperidine]-1'-yl)acetic acid.
| Compound Name | 2-(7-ethoxyspiro[chromene-2,4'-piperidine]-1'-yl)acetic acid |
|---|---|
| PubChem CID | 82046695 |
| Molecular Formula | C17H21NO4 |
| Molecular Weight | 303.36 g/mol |
| Exact Mass | 303.15 |
| IUPAC Name | 2-(7-ethoxyspiro[chromene-2,4'-piperidine]-1'-yl)acetic acid |
| SMILES | CCOc1ccc2c(c1)OC1(C=C2)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C17H21NO4/c1-2-21-14-4-3-13-5-6-17(22-15(13)11-14)7-9-18(10-8-17)12-16(19)20/h3-6,11H,2,7-10,12H2,1H3,(H,19,20) |
| InChIKey | YSZBLQUCSKDPEH-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.36 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |