C16H19NO4 — CID 82046698
2-(5-methoxyspiro[chromene-2,4'-piperidine]-1'-yl)acetic acid (PubChem CID 82046698) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 2-(5-methoxyspiro[chromene-2,4'-piperidine]-1'-yl)acetic acid.
| Compound Name | 2-(5-methoxyspiro[chromene-2,4'-piperidine]-1'-yl)acetic acid |
|---|---|
| PubChem CID | 82046698 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 2-(5-methoxyspiro[chromene-2,4'-piperidine]-1'-yl)acetic acid |
| SMILES | COc1cccc2c1C=CC1(CCN(CC(=O)O)CC1)O2 |
| InChI | InChI=1S/C16H19NO4/c1-20-13-3-2-4-14-12(13)5-6-16(21-14)7-9-17(10-8-16)11-15(18)19/h2-6H,7-11H2,1H3,(H,18,19) |
| InChIKey | CJIFYIQLEAVNKV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |