C14H14ClNO3 — CID 82047044
2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid (PubChem CID 82047044) has the molecular formula C14H14ClNO3 and a molecular weight of 279.72 g/mol. Its IUPAC name is 2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid.
| Compound Name | 2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid |
|---|---|
| PubChem CID | 82047044 |
| Molecular Formula | C14H14ClNO3 |
| Molecular Weight | 279.72 g/mol |
| Exact Mass | 279.07 |
| IUPAC Name | 2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid |
| SMILES | O=C(O)CN1CCC2(C=Cc3cc(Cl)ccc3O2)C1 |
| InChI | InChI=1S/C14H14ClNO3/c15-11-1-2-12-10(7-11)3-4-14(19-12)5-6-16(9-14)8-13(17)18/h1-4,7H,5-6,8-9H2,(H,17,18) |
| InChIKey | KCRJQAKWNATQIT-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.72 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |