2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid

C14H14ClNO3 — CID 82047044

IUPAC2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid
SMILESO=C(O)CN1CCC2(C=Cc3cc(Cl)ccc3O2)C1
InChIInChI=1S/C14H14ClNO3/c15-11-1-2-12-10(7-11)3-4-14(19-12)5-6-16(9-14)8-13(17)18/h1-4,7H,5-6,8-9H2,(H,17,18)
InChIKeyKCRJQAKWNATQIT-UHFFFAOYSA-N
MW279.72 g/mol
LogP2.27
Rot. Bonds2

About 2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid

2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid (PubChem CID 82047044) has the molecular formula C14H14ClNO3 and a molecular weight of 279.72 g/mol. Its IUPAC name is 2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid.

Molecular Properties

Compound Name2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid
PubChem CID82047044
Molecular FormulaC14H14ClNO3
Molecular Weight279.72 g/mol
Exact Mass279.07
IUPAC Name2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid
SMILESO=C(O)CN1CCC2(C=Cc3cc(Cl)ccc3O2)C1
InChIInChI=1S/C14H14ClNO3/c15-11-1-2-12-10(7-11)3-4-14(19-12)5-6-16(9-14)8-13(17)18/h1-4,7H,5-6,8-9H2,(H,17,18)
InChIKeyKCRJQAKWNATQIT-UHFFFAOYSA-N
XLogP2.27
TPSA49.77 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.72
LogP ≤ 52.27
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid?
The IUPAC name of 2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid (CID 82047044) is 2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid.
What is the SMILES notation for 2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid?
The canonical SMILES for 2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid is O=C(O)CN1CCC2(C=Cc3cc(Cl)ccc3O2)C1.
What is the InChIKey of 2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid?
The InChIKey is KCRJQAKWNATQIT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14ClNO3/c15-11-1-2-12-10(7-11)3-4-14(19-12)5-6-16(9-14)8-13(17)18/h1-4,7H,5-6,8-9H2,(H,17,18).
What are the key properties of 2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid?
2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid has a molecular weight of 279.72 g/mol, XLogP of 2.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-chlorospiro[chromene-2,3'-pyrrolidine]-1'-yl)acetic acid is sourced from PubChem (CID 82047044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).