C17H23NO2 — CID 82045814
6-butoxyspiro[chromene-2,4'-piperidine] (PubChem CID 82045814) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 6-butoxyspiro[chromene-2,4'-piperidine].
| Compound Name | 6-butoxyspiro[chromene-2,4'-piperidine] |
|---|---|
| PubChem CID | 82045814 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 6-butoxyspiro[chromene-2,4'-piperidine] |
| SMILES | CCCCOc1ccc2c(c1)C=CC1(CCNCC1)O2 |
| InChI | InChI=1S/C17H23NO2/c1-2-3-12-19-15-4-5-16-14(13-15)6-7-17(20-16)8-10-18-11-9-17/h4-7,13,18H,2-3,8-12H2,1H3 |
| InChIKey | HDAOSDRWTGSRQX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|