C17H23NO — CID 150143821
6-tert-butylspiro[chromene-2,4'-piperidine] (PubChem CID 150143821) has the molecular formula C17H23NO and a molecular weight of 257.38 g/mol. Its IUPAC name is 6-tert-butylspiro[chromene-2,4'-piperidine].
| Compound Name | 6-tert-butylspiro[chromene-2,4'-piperidine] |
|---|---|
| PubChem CID | 150143821 |
| Molecular Formula | C17H23NO |
| Molecular Weight | 257.38 g/mol |
| Exact Mass | 257.18 |
| IUPAC Name | 6-tert-butylspiro[chromene-2,4'-piperidine] |
| SMILES | CC(C)(C)c1ccc2c(c1)C=CC1(CCNCC1)O2 |
| InChI | InChI=1S/C17H23NO/c1-16(2,3)14-4-5-15-13(12-14)6-7-17(19-15)8-10-18-11-9-17/h4-7,12,18H,8-11H2,1-3H3 |
| InChIKey | FDVHNEBFNAAZNS-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.38 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |